CAS 1365808-08-7 is the registry number for 2,2,3,3-Tetrafluoropropyl 2,2-difluoroacetate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,2,3,3-tetrafluoropropyl 2,2-difluoroacetate (CAS 1365808-08-7) is a chemical compound with the molecular formula C5H4F6O2 and a molecular weight of 210.07 g/mol. IUPAC name: 2,2,3,3-tetrafluoropropyl 2,2-difluoroacetate. InChIKey: JXIXWHXKUMLBSQ-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O2 |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoropropyl 2,2-difluoroacetate |
| InChIKey | JXIXWHXKUMLBSQ-UHFFFAOYSA-N |
| SMILES | C(C(C(F)F)(F)F)OC(=O)C(F)F |
Computed by PubChem (NCBI)