Products 1365808-08-7

CAS 1365808-08-7 is the registry number for 2,2,3,3-Tetrafluoropropyl 2,2-difluoroacetate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2,2,3,3-tetrafluoropropyl 2,2-difluoroacetate (CAS 1365808-08-7) is a chemical compound with the molecular formula C5H4F6O2 and a molecular weight of 210.07 g/mol. IUPAC name: 2,2,3,3-tetrafluoropropyl 2,2-difluoroacetate. InChIKey: JXIXWHXKUMLBSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4F6O2
Molecular weight210.07 g/mol
IUPAC name2,2,3,3-tetrafluoropropyl 2,2-difluoroacetate
InChIKeyJXIXWHXKUMLBSQ-UHFFFAOYSA-N
SMILESC(C(C(F)F)(F)F)OC(=O)C(F)F

Computed by PubChem (NCBI)