Products 136590-28-8
CAS 136590-28-8 appears in our catalog under these names: Pravastatin EP Impurity G, Pravastatin Impurity 7（Pravastatin EP Impurity G）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,5R)-3,5-dihydroxy-7-[(1S,2S)-6-hydroxy-2-methyl-1,2-dihydronaphthalen-1-yl]heptanoic acid (CAS 136590-28-8) is a chemical compound with the molecular formula C18H24O5 and a molecular weight of 320.4 g/mol. IUPAC name: (3R,5R)-3,5-dihydroxy-7-[(1S,2S)-6-hydroxy-2-methyl-1,2-dihydronaphthalen-1-yl]heptanoic acid. InChIKey: STGSFABFWFDJSQ-SRMUXQRQSA-N.
| Molecular formula | C18H24O5 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | (3R,5R)-3,5-dihydroxy-7-[(1S,2S)-6-hydroxy-2-methyl-1,2-dihydronaphthalen-1-yl]heptanoic acid |
| InChIKey | STGSFABFWFDJSQ-SRMUXQRQSA-N |
| SMILES | C[C@H]1C=CC2=C([C@H]1CC[C@H](C[C@H](CC(=O)O)O)O)C=CC(=C2)O |
Computed by PubChem (NCBI)