CAS 22518-03-2 is the registry number for 8,9–Dehydro–7,9–diisobutyryloxythymol. Offered by: GLPBio. Available pack sizes: 5mg.
[3-hydroxy-4-[(E)-1-(2-methylpropanoyloxy)prop-1-en-2-yl]phenyl]methyl 2-methylpropanoate (CAS 22518-03-2) is a chemical compound with the molecular formula C18H24O5 and a molecular weight of 320.4 g/mol. IUPAC name: [3-hydroxy-4-[(E)-1-(2-methylpropanoyloxy)prop-1-en-2-yl]phenyl]methyl 2-methylpropanoate. InChIKey: BZJQETVPXZIJDR-UKTHLTGXSA-N.
| Molecular formula | C18H24O5 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | [3-hydroxy-4-[(E)-1-(2-methylpropanoyloxy)prop-1-en-2-yl]phenyl]methyl 2-methylpropanoate |
| InChIKey | BZJQETVPXZIJDR-UKTHLTGXSA-N |
| SMILES | CC(C)C(=O)OCC1=CC(=C(C=C1)/C(=C/OC(=O)C(C)C)/C)O |
Computed by PubChem (NCBI)