Products 140918-54-3

CAS 140918-54-3 is the registry number for 4-((8-(Acryloyloxy)octyl)oxy)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(8-prop-2-enoyloxyoctoxy)benzoic acid (CAS 140918-54-3) is a chemical compound with the molecular formula C18H24O5 and a molecular weight of 320.4 g/mol. IUPAC name: 4-(8-prop-2-enoyloxyoctoxy)benzoic acid. InChIKey: NILHWSPFJLBSCB-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24O5
Molecular weight320.4 g/mol
IUPAC name4-(8-prop-2-enoyloxyoctoxy)benzoic acid
InChIKeyNILHWSPFJLBSCB-UHFFFAOYSA-N
SMILESC=CC(=O)OCCCCCCCCOC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)