CAS 35931-68-1 is the registry number for Dimethyl Cladosporin. Offered by: TRC. Available pack sizes: 100mg.
(3R)-6,8-dimethoxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one (CAS 35931-68-1) is a chemical compound with the molecular formula C18H24O5 and a molecular weight of 320.4 g/mol. IUPAC name: (3R)-6,8-dimethoxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one. InChIKey: PBNWYXJTPLKLOB-NJZAAPMLSA-N.
| Molecular formula | C18H24O5 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | (3R)-6,8-dimethoxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one |
| InChIKey | PBNWYXJTPLKLOB-NJZAAPMLSA-N |
| SMILES | C[C@H]1CCC[C@@H](O1)C[C@H]2CC3=C(C(=CC(=C3)OC)OC)C(=O)O2 |
Computed by PubChem (NCBI)