CAS 1365937-12-7 is the registry number for (S)-1-(Quinazolin-4-yl)pyrrolidin-3-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(3S)-1-quinazolin-4-ylpyrrolidin-3-amine (CAS 1365937-12-7) is a chemical compound with the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. IUPAC name: (3S)-1-quinazolin-4-ylpyrrolidin-3-amine. InChIKey: JUOPLTBLHDAQTE-VIFPVBQESA-N.
| Molecular formula | C12H14N4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | (3S)-1-quinazolin-4-ylpyrrolidin-3-amine |
| InChIKey | JUOPLTBLHDAQTE-VIFPVBQESA-N |
| SMILES | C1CN(C[C@H]1N)C2=NC=NC3=CC=CC=C32 |
Computed by PubChem (NCBI)