Products 1366505-88-5
CAS 1366505-88-5 is the registry number for (3R)-3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-(3-iodophenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid (CAS 1366505-88-5) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid. InChIKey: SKTSPSIMLVUKHC-JOCHJYFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid |
| InChIKey | SKTSPSIMLVUKHC-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC(=CC=C4)I |
Computed by PubChem (NCBI)