CAS 210282-32-9 appears in our catalog under these names: Fmoc–Phe(2–I)–OH, Fmoc-Phe(2-I)-OH 98%, Fmoc-Phe(2-I)-OH, 98%, 98%, Fmoc-Phe(2-I)-OH, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-iodophenyl)propanoic acid (CAS 210282-32-9) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-iodophenyl)propanoic acid. InChIKey: YMKDZEDXFIXGNK-QFIPXVFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-iodophenyl)propanoic acid |
| InChIKey | YMKDZEDXFIXGNK-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)I |
Computed by PubChem (NCBI)