CAS 478183-65-2 appears in our catalog under these names: Fmoc–2–iodo–D–phenylalanine, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-iodophenyl)propanoic acid, ≥98%, Fmoc-D-Phe(2-I)-OH, 98%, Fmoc-2-iodo-D-phenylalanine, ≥98%, ≥98%. Offered by: GLPBio, Fluorochem, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-iodophenyl)propanoic acid (CAS 478183-65-2) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-iodophenyl)propanoic acid. InChIKey: YMKDZEDXFIXGNK-JOCHJYFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-iodophenyl)propanoic acid |
| InChIKey | YMKDZEDXFIXGNK-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)I |
Computed by PubChem (NCBI)