CAS 210282-31-8 appears in our catalog under these names: (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–(3–iodophenyl)propanoic acid, Fmoc-L-Phe(3-I)-OH, Fmoc-Phe(3-I)-OH 95%, Fmoc-L-3-Iodophenylalanine, 95%, 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-iodophenyl)propanoic acid, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 25g, 500mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid (CAS 210282-31-8) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid. InChIKey: SSKOJXLIQFVOGC-QFIPXVFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid |
| InChIKey | SSKOJXLIQFVOGC-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)I)C(=O)O |
Computed by PubChem (NCBI)