CAS 1367242-84-9 is the registry number for AOZ-HN. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
3-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,3-oxazolidin-2-one (CAS 1367242-84-9) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 3-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,3-oxazolidin-2-one. InChIKey: YGHGUXXEPZHHTD-DHDCSXOGSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 3-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,3-oxazolidin-2-one |
| InChIKey | YGHGUXXEPZHHTD-DHDCSXOGSA-N |
| SMILES | C1COC(=O)N1/N=C\C2=C(C=CC3=CC=CC=C32)O |
Computed by PubChem (NCBI)