CAS 1367269-14-4 is the registry number for Methyl 5-nitroisoxazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-nitro-1,2-oxazole-3-carboxylate (CAS 1367269-14-4) is a chemical compound with the molecular formula C5H4N2O5 and a molecular weight of 172.10 g/mol. IUPAC name: methyl 5-nitro-1,2-oxazole-3-carboxylate. InChIKey: ALZGDNKOHYRWBP-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O5 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | methyl 5-nitro-1,2-oxazole-3-carboxylate |
| InChIKey | ALZGDNKOHYRWBP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)