Products 1367269-14-4

CAS 1367269-14-4 is the registry number for Methyl 5-nitroisoxazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-nitro-1,2-oxazole-3-carboxylate (CAS 1367269-14-4) is a chemical compound with the molecular formula C5H4N2O5 and a molecular weight of 172.10 g/mol. IUPAC name: methyl 5-nitro-1,2-oxazole-3-carboxylate. InChIKey: ALZGDNKOHYRWBP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4N2O5
Molecular weight172.10 g/mol
IUPAC namemethyl 5-nitro-1,2-oxazole-3-carboxylate
InChIKeyALZGDNKOHYRWBP-UHFFFAOYSA-N
SMILESCOC(=O)C1=NOC(=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)