CAS 960225-75-6 appears in our catalog under these names: 5-Methyl-4-nitro-3-isoxazolecarboxylic acid, 10% in THF under Argon, 95%, 5–Methyl–4–nitro–3–isoxazolecarboxylic acid, 5-Methyl-4-nitro-3-isoxazolecarboxylic acid 95%, 5-Methyl-4-nitro-3-isoxazolecarboxylic acid 10% in THF, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 2.5g.
5-methyl-4-nitro-1,2-oxazole-3-carboxylic acid (CAS 960225-75-6) is a chemical compound with the molecular formula C5H4N2O5 and a molecular weight of 172.10 g/mol. IUPAC name: 5-methyl-4-nitro-1,2-oxazole-3-carboxylic acid. InChIKey: GIRMISJOXYRPLD-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O5 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 5-methyl-4-nitro-1,2-oxazole-3-carboxylic acid |
| InChIKey | GIRMISJOXYRPLD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)