CAS 69579-38-0 is the registry number for 2-Oxo-2,3-dihydro-1H-imidazole-4,5-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-oxo-1,3-dihydroimidazole-4,5-dicarboxylic acid (CAS 69579-38-0) is a chemical compound with the molecular formula C5H4N2O5 and a molecular weight of 172.10 g/mol. IUPAC name: 2-oxo-1,3-dihydroimidazole-4,5-dicarboxylic acid. InChIKey: ZCMFGAUGQICCIB-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O5 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroimidazole-4,5-dicarboxylic acid |
| InChIKey | ZCMFGAUGQICCIB-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)