CAS 89282-14-4 is the registry number for 1-Hydroxy-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-hydroxy-2,4-dioxopyrimidine-5-carboxylic acid (CAS 89282-14-4) is a chemical compound with the molecular formula C5H4N2O5 and a molecular weight of 172.10 g/mol. IUPAC name: 1-hydroxy-2,4-dioxopyrimidine-5-carboxylic acid. InChIKey: IMIYZZJJQRVOFA-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O5 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 1-hydroxy-2,4-dioxopyrimidine-5-carboxylic acid |
| InChIKey | IMIYZZJJQRVOFA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1O)C(=O)O |
Computed by PubChem (NCBI)