CAS 136765-29-2 appears in our catalog under these names: Clomipramine D3, Clomipramine D3, Clomipramine-d3 HCl, Clomipramine-d3. Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine (CAS 136765-29-2) is a chemical compound with the molecular formula C19H23ClN2 and a molecular weight of 317.9 g/mol. IUPAC name: 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine. InChIKey: GDLIGKIOYRNHDA-FIBGUPNXSA-N.
| Molecular formula | C19H23ClN2 |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine |
| InChIKey | GDLIGKIOYRNHDA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CCCN1C2=CC=CC=C2CCC3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)