CAS 63867-26-5 is the registry number for (3RS)-4-(Dimethylamino)-3-methyl-2,2-diphenylbutanenitrile Hydrochloride (Isodidiavalo Hydrochloride). Offered by: Mikromol. Available pack sizes: 50mg.
(3-cyano-2-methyl-3,3-diphenylpropyl)-dimethylazanium chloride (CAS 63867-26-5) is a chemical compound with the molecular formula C19H23ClN2 and a molecular weight of 314.9 g/mol. IUPAC name: (3-cyano-2-methyl-3,3-diphenylpropyl)-dimethylazanium chloride. InChIKey: JJLGTRNWSYAQKN-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN2 |
|---|---|
| Molecular weight | 314.9 g/mol |
| IUPAC name | (3-cyano-2-methyl-3,3-diphenylpropyl)-dimethylazanium chloride |
| InChIKey | JJLGTRNWSYAQKN-UHFFFAOYSA-N |
| SMILES | CC(C[NH+](C)C)C(C#N)(C1=CC=CC=C1)C2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)