Products 58262-51-4
CAS 58262-51-4 appears in our catalog under these names: Imipramine Impurity B HCl, Balipramine Hydrochloride (Impurity), >95% (HPLC), Depramine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 0,5g, 50mg.
3-benzo[b][1]benzazepin-11-yl-N,N-dimethylpropan-1-amine;hydrochloride (CAS 58262-51-4) is a chemical compound with the molecular formula C19H23ClN2 and a molecular weight of 314.9 g/mol. IUPAC name: 3-benzo[b][1]benzazepin-11-yl-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: QHOQDRVNCMCLDK-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN2 |
|---|---|
| Molecular weight | 314.9 g/mol |
| IUPAC name | 3-benzo[b][1]benzazepin-11-yl-N,N-dimethylpropan-1-amine;hydrochloride |
| InChIKey | QHOQDRVNCMCLDK-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2C=CC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)
Synonyms:
Balipramine Hydrochloride (Impurity), N,N-Dimethyl-5H-dibenz(b,f)azepine-5-propanamine monohydrochloride, Imipramine Hydrochloride Impurity B, 3-benzo[b][1]benzazepin-11-yl-N,N-dimethylpropan-1-amine;hydrochloride, G 31406 hydrochloride, Imipramine Impurity B HCl, orb2815050, G 31406 HCl, 5H-Dibenz(b,f)azepine-5-propanamine, N,N-dimethyl-, monohydrochloride, 1-(gamma-Dimethylaminopropyl)-5 dibenzo(b,f) 5H azepine chlorhydrate [French]