CAS 51657-91-1 is the registry number for Z-Triprolidine Hydrochloride. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine;hydrochloride (CAS 51657-91-1) is a chemical compound with the molecular formula C19H23ClN2 and a molecular weight of 314.9 g/mol. IUPAC name: 2-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine;hydrochloride. InChIKey: WYUYEJNGHIOFOC-VVTVMFAVSA-N.
| Molecular formula | C19H23ClN2 |
|---|---|
| Molecular weight | 314.9 g/mol |
| IUPAC name | 2-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine;hydrochloride |
| InChIKey | WYUYEJNGHIOFOC-VVTVMFAVSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=C/CN2CCCC2)/C3=CC=CC=N3.Cl |
Computed by PubChem (NCBI)