CAS 136765-45-2 appears in our catalog under these names: Nitrazepam-d5, >95% (HPLC), Nitrazepam-D5, Nitrazepam-D5 0.1 mg/ml in Acetonitrile, Nitrazepam-D5, 0.1mg/ml in Acetonitrile, Nitrazepam-D5, 1mg/ml in Acetonitrile. Offered by: TRC, Lipomed, LoGiCal, Biosynth. Available pack sizes: 10mg, 1mg, 50mg, 100mg, 1ml, 5mg, 25mg.
7-nitro-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 136765-45-2) is a chemical compound with the molecular formula C15H11N3O3 and a molecular weight of 286.30 g/mol. IUPAC name: 7-nitro-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: KJONHKAYOJNZEC-RALIUCGRSA-N.
| Molecular formula | C15H11N3O3 |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | 7-nitro-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | KJONHKAYOJNZEC-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=NCC(=O)NC3=C2C=C(C=C3)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)