Products 847021-86-7
CAS 847021-86-7 is the registry number for 5-(2-Formyl-1H-pyrrol-1-yl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-formylpyrrol-1-yl)-1-phenylpyrazole-4-carboxylic acid (CAS 847021-86-7) is a chemical compound with the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. IUPAC name: 5-(2-formylpyrrol-1-yl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: FSDBBTBXAMNMDO-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O3 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 5-(2-formylpyrrol-1-yl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | FSDBBTBXAMNMDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(C=N2)C(=O)O)N3C=CC=C3C=O |
Computed by PubChem (NCBI)