Products 62507-52-2
CAS 62507-52-2 is the registry number for 2-(4-Nitrophenyl)-5-(p-tolyl)-1,3,4-oxadiazole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methylphenyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole (CAS 62507-52-2) is a chemical compound with the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. IUPAC name: 2-(4-methylphenyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole. InChIKey: MKOUNTLDPGHNHQ-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O3 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 2-(4-methylphenyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | MKOUNTLDPGHNHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C(O2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)