Products 327091-99-6
CAS 327091-99-6 is the registry number for 2-(1H-1,3-Benzodiazol-2-yl)-1-(4-nitrophenyl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(1H-benzimidazol-2-yl)-1-(4-nitrophenyl)ethanone (CAS 327091-99-6) is a chemical compound with the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. IUPAC name: 2-(1H-benzimidazol-2-yl)-1-(4-nitrophenyl)ethanone. InChIKey: JEJGEGYUJTXFRK-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O3 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-yl)-1-(4-nitrophenyl)ethanone |
| InChIKey | JEJGEGYUJTXFRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)