Products 1368146-30-8
CAS 1368146-30-8 is the registry number for 6-Bromo-7-chloro-1,2,3,4-tetrahydroquinoline, 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-bromo-7-chloro-1,2,3,4-tetrahydroquinoline (CAS 1368146-30-8) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 6-bromo-7-chloro-1,2,3,4-tetrahydroquinoline. InChIKey: HGTFKDUKRKQWFF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 6-bromo-7-chloro-1,2,3,4-tetrahydroquinoline |
| InChIKey | HGTFKDUKRKQWFF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2NC1)Cl)Br |
Computed by PubChem (NCBI)