Products 1368168-29-9
CAS 1368168-29-9 is the registry number for 5-Formylpyrazolo(1,5-a)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-formylpyrazolo[1,5-a]pyridine-3-carboxylic acid (CAS 1368168-29-9) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 5-formylpyrazolo[1,5-a]pyridine-3-carboxylic acid. InChIKey: KVEMOOHREMNROK-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-formylpyrazolo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | KVEMOOHREMNROK-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)C=C1C=O |
Computed by PubChem (NCBI)