Products 136818-58-1
CAS 136818-58-1 is the registry number for Methyl 6-(dimethylamino)-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 6-(dimethylamino)-1H-indole-2-carboxylate (CAS 136818-58-1) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: methyl 6-(dimethylamino)-1H-indole-2-carboxylate. InChIKey: IIGZZJJTRBYJLR-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | methyl 6-(dimethylamino)-1H-indole-2-carboxylate |
| InChIKey | IIGZZJJTRBYJLR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C(N2)C(=O)OC |
Computed by PubChem (NCBI)