CAS 1368183-63-4 is the registry number for 4-Chloro-7-methylindolin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-7-methyl-1,2-dihydroindol-3-one (CAS 1368183-63-4) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-7-methyl-1,2-dihydroindol-3-one. InChIKey: JFTIFFDYIXQUJJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-7-methyl-1,2-dihydroindol-3-one |
| InChIKey | JFTIFFDYIXQUJJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)C(=O)CN2 |
Computed by PubChem (NCBI)