Products 1368465-26-2

CAS 1368465-26-2 is the registry number for 2-Chloro-2-(3-chlorophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-chloro-2-(3-chlorophenyl)acetic acid (CAS 1368465-26-2) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-chloro-2-(3-chlorophenyl)acetic acid. InChIKey: KTDVGGSTOFEZKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O2
Molecular weight205.03 g/mol
IUPAC name2-chloro-2-(3-chlorophenyl)acetic acid
InChIKeyKTDVGGSTOFEZKZ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)C(C(=O)O)Cl

Computed by PubChem (NCBI)