Products 1368589-20-1
CAS 1368589-20-1 appears in our catalog under these names: 1-Isobutyryl-1H-indole-3-carboxylic acid, 97%, 97%, 1-Isobutyryl-1H-indole-3-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(2-methylpropanoyl)indole-3-carboxylic acid (CAS 1368589-20-1) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 1-(2-methylpropanoyl)indole-3-carboxylic acid. InChIKey: CNTNJQAYZXKCCR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 1-(2-methylpropanoyl)indole-3-carboxylic acid |
| InChIKey | CNTNJQAYZXKCCR-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)N1C=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)