Products 1368615-60-4
CAS 1368615-60-4 is the registry number for 4-​(1,​1-​Dioxido-​1,​2,​5-​thiadiazolidin-​2-​yl)​-benzenamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline (CAS 1368615-60-4) is a chemical compound with the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. IUPAC name: 4-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline. InChIKey: IWYWMZXVRBJVPT-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline |
| InChIKey | IWYWMZXVRBJVPT-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)N1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)