CAS 1368732-31-3 is the registry number for 2-Benzyl-1-methyl-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-benzyl-1-methylbenzimidazole-5-carboxylic acid (CAS 1368732-31-3) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 2-benzyl-1-methylbenzimidazole-5-carboxylic acid. InChIKey: AICYRTAFWQHKFR-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2-benzyl-1-methylbenzimidazole-5-carboxylic acid |
| InChIKey | AICYRTAFWQHKFR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)O)N=C1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)