Products 1368741-02-9

CAS 1368741-02-9 is the registry number for 2-Hydroxy-2-(4-(methylsulfonyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-hydroxy-2-(4-methylsulfonylphenyl)acetic acid (CAS 1368741-02-9) is a chemical compound with the molecular formula C9H10O5S and a molecular weight of 230.24 g/mol. IUPAC name: 2-hydroxy-2-(4-methylsulfonylphenyl)acetic acid. InChIKey: BGZXFINNZQVMQH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O5S
Molecular weight230.24 g/mol
IUPAC name2-hydroxy-2-(4-methylsulfonylphenyl)acetic acid
InChIKeyBGZXFINNZQVMQH-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=C(C=C1)C(C(=O)O)O

Computed by PubChem (NCBI)