CAS 42288-41-5 appears in our catalog under these names: 2-(4-Methanesulfonylphenoxy)acetic acid, 95%, 2-(4-Methanesulfonylphenoxy)acetic acid, 2-(4-methanesulfonylphenoxy)acetic acid, 98%, 98%, 2-(4-(METHYLSULFONYL)PHENOXY)ACETIC ACID, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g, 100mg.
2-(4-methylsulfonylphenoxy)acetic acid (CAS 42288-41-5) is a chemical compound with the molecular formula C9H10O5S and a molecular weight of 230.24 g/mol. IUPAC name: 2-(4-methylsulfonylphenoxy)acetic acid. InChIKey: ZDUFIHMADJNVIQ-UHFFFAOYSA-N.
| Molecular formula | C9H10O5S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenoxy)acetic acid |
| InChIKey | ZDUFIHMADJNVIQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)OCC(=O)O |
Computed by PubChem (NCBI)