CAS 64369-79-5 appears in our catalog under these names: 4-[(Methylsulfonyl)oxy]-benzeneacetic acid, 95%, 2-(4-((Methylsulfonyl)oxy)phenyl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-(4-methylsulfonyloxyphenyl)acetic acid (CAS 64369-79-5) is a chemical compound with the molecular formula C9H10O5S and a molecular weight of 230.24 g/mol. IUPAC name: 2-(4-methylsulfonyloxyphenyl)acetic acid. InChIKey: QTOQTPBCDMNMCK-UHFFFAOYSA-N.
| Molecular formula | C9H10O5S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2-(4-methylsulfonyloxyphenyl)acetic acid |
| InChIKey | QTOQTPBCDMNMCK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)