Products 39794-77-9
CAS 39794-77-9 appears in our catalog under these names: 2-(Tosyloxy)acetic acid, 95-<97%, 2–(p–Toluenesulfonyloxy)acetic Acid, 2-(p-Toluenesulfonyloxy)acetic Acid, 2-(p-Toluenesulfonyloxy)acetic Acid, >97.0%(GC)(T), Tosylglycolic Acid 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 250mg, 2,5g.
2-(4-methylphenyl)sulfonyloxyacetic acid (CAS 39794-77-9) is a chemical compound with the molecular formula C9H10O5S and a molecular weight of 230.24 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyloxyacetic acid. InChIKey: NSORSORRXHLKQV-UHFFFAOYSA-N.
| Molecular formula | C9H10O5S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyloxyacetic acid |
| InChIKey | NSORSORRXHLKQV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(p-Toluenesulfonyloxy)acetic Acid, 2-(Tosyloxy)acetic acid, 2-(4-methylphenyl)sulfonyloxyacetic acid, {[(4-methylphenyl)sulfonyl]oxy}acetic acid, TosylglycolicAcid, 2-[[(4-Methylphenyl)sulfonyl]oxy]acetic Acid, 2-[(4-methylbenzenesulfonyl)oxy]acetic acid, (((4-methylphenyl)sulfonyl)oxy)acetic acid, [(4-Methylbenzene-1-sulfonyl)oxy]acetic acid, NCIStruc1_000495