Products 1368752-05-9
CAS 1368752-05-9 appears in our catalog under these names: 2-Chloro-2-(3,4-dichlorophenyl)acetic acid, 95%, 2-Chloro-2-(3,4-dichlorophenyl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-2-(3,4-dichlorophenyl)acetic acid (CAS 1368752-05-9) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: 2-chloro-2-(3,4-dichlorophenyl)acetic acid. InChIKey: KITYSJQANLRAJJ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2-chloro-2-(3,4-dichlorophenyl)acetic acid |
| InChIKey | KITYSJQANLRAJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)Cl)Cl)Cl |
Computed by PubChem (NCBI)