CAS 2694-06-6 appears in our catalog under these names: Methyl 2,3,6-trichlorobenzoate, 95%, Methyl 2,3,6-trichlorobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 2,3,6-trichlorobenzoate (CAS 2694-06-6) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: methyl 2,3,6-trichlorobenzoate. InChIKey: OAWDHDKEHFFNQQ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | methyl 2,3,6-trichlorobenzoate |
| InChIKey | OAWDHDKEHFFNQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)