CAS 774-74-3 appears in our catalog under these names: (2,4-Dichlorophenoxy)acetyl chloride, 95%, (2,4-Dichlorophenoxy)acetyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
2-(2,4-dichlorophenoxy)acetyl chloride (CAS 774-74-3) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)acetyl chloride. InChIKey: FUJSJWRORKKPAI-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)acetyl chloride |
| InChIKey | FUJSJWRORKKPAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)Cl |
Computed by PubChem (NCBI)