Products 774-74-3

CAS 774-74-3 appears in our catalog under these names: (2,4-Dichlorophenoxy)acetyl chloride, 95%, (2,4-Dichlorophenoxy)acetyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-(2,4-dichlorophenoxy)acetyl chloride (CAS 774-74-3) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)acetyl chloride. InChIKey: FUJSJWRORKKPAI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Cl3O2
Molecular weight239.5 g/mol
IUPAC name2-(2,4-dichlorophenoxy)acetyl chloride
InChIKeyFUJSJWRORKKPAI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)OCC(=O)Cl

Computed by PubChem (NCBI)