Products 70190-72-6
CAS 70190-72-6 appears in our catalog under these names: 2,4-Dichlorobenzoic acid chloromethyl ester, 95%, 2,4-Dichlorobenzoic acid chloromethyl ester, 97%, 97%, 2,4-DICHLOROBENZOIC ACID CHLOROMETHYL ESTER, 97%, Chloromethyl 2,4-dichlorobenzoate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
Chloromethyl 2,4-dichlorobenzoate (CAS 70190-72-6) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: chloromethyl 2,4-dichlorobenzoate. InChIKey: DOIDCVLQRFSVNF-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | chloromethyl 2,4-dichlorobenzoate |
| InChIKey | DOIDCVLQRFSVNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)OCCl |
Computed by PubChem (NCBI)