CAS 1368780-82-8 appears in our catalog under these names: 8-Bromo-6-chloro-1,2,3,4-tetrahydroquinoline, 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline, 97%, 8-Bromo-6-chloro-1,2,3,4-tetrahydroquinoline, 97%, 97%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 500mg, 1g.
8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline (CAS 1368780-82-8) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline. InChIKey: FIGCYUUCCAJSQG-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline |
| InChIKey | FIGCYUUCCAJSQG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)Cl)Br)NC1 |
Computed by PubChem (NCBI)