Products 1368872-95-0
CAS 1368872-95-0 is the registry number for 2-((2,3-Dihydro-2-oxo-1H-indol-5-yl)methyl)-4-thiazolecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-[(2-oxo-1,3-dihydroindol-5-yl)methyl]-1,3-thiazole-4-carboxylic acid (CAS 1368872-95-0) is a chemical compound with the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. IUPAC name: 2-[(2-oxo-1,3-dihydroindol-5-yl)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: XWIOSXJHNIOKSX-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 2-[(2-oxo-1,3-dihydroindol-5-yl)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | XWIOSXJHNIOKSX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)CC3=NC(=CS3)C(=O)O)NC1=O |
Computed by PubChem (NCBI)