CAS 879352-51-9 is the registry number for Methyl 3-methyl-6-thien-2-ylisoxazolo(5,4-b)pyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (CAS 879352-51-9) is a chemical compound with the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. IUPAC name: methyl 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate. InChIKey: VPRNZEXUCULYDM-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | methyl 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| InChIKey | VPRNZEXUCULYDM-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CC=CS3)C(=O)OC |
Computed by PubChem (NCBI)