CAS 924191-70-8 appears in our catalog under these names: 3-Methyl-6-(5-methylthien-2-yl)isoxazolo[5,4-b]pyridine-4-carboxylic acid, 95%, 3-Methyl-6-(5-methylthiophen-2-yl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 924191-70-8) is a chemical compound with the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. IUPAC name: 3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: PAVYUFBDOSJQBP-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | PAVYUFBDOSJQBP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=NC3=C(C(=NO3)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)