CAS 628337-03-1 is the registry number for 1,3–Dioxo–2–(2–oxo–6–thioxopiperidin–3–yl)isoindoline. Offered by: GLPBio. Available pack sizes: 10mg.
2-(2-oxo-6-sulfanylidenepiperidin-3-yl)isoindole-1,3-dione (CAS 628337-03-1) is a chemical compound with the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. IUPAC name: 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)isoindole-1,3-dione. InChIKey: FNFLWRDNFCUNQT-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | FNFLWRDNFCUNQT-UHFFFAOYSA-N |
| SMILES | C1CC(=S)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)