CAS 1368975-22-7 is the registry number for 1,5-Dichloro-3-isothiocyanato-2-methoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,5-dichloro-3-isothiocyanato-2-methoxybenzene (CAS 1368975-22-7) is a chemical compound with the molecular formula C8H5Cl2NOS and a molecular weight of 234.10 g/mol. IUPAC name: 1,5-dichloro-3-isothiocyanato-2-methoxybenzene. InChIKey: BWPFAUJRXKHDEB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NOS |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 1,5-dichloro-3-isothiocyanato-2-methoxybenzene |
| InChIKey | BWPFAUJRXKHDEB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)N=C=S |
Computed by PubChem (NCBI)