CAS 199293-12-4 appears in our catalog under these names: 5,7-Dichloro-6-methyl-1,3-benzoxazole-2-thiol, 95%, 5,7-Dichloro-6-methylbenzo(d)oxazole-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
5,7-dichloro-6-methyl-3H-1,3-benzoxazole-2-thione (CAS 199293-12-4) is a chemical compound with the molecular formula C8H5Cl2NOS and a molecular weight of 234.10 g/mol. IUPAC name: 5,7-dichloro-6-methyl-3H-1,3-benzoxazole-2-thione. InChIKey: HXLKSPUYOZZJBE-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NOS |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 5,7-dichloro-6-methyl-3H-1,3-benzoxazole-2-thione |
| InChIKey | HXLKSPUYOZZJBE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Cl)OC(=S)N2)Cl |
Computed by PubChem (NCBI)