CAS 430535-13-0 appears in our catalog under these names: 4-(Chloromethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole, 95%, 4-(Chloromethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(chloromethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole (CAS 430535-13-0) is a chemical compound with the molecular formula C8H5Cl2NOS and a molecular weight of 234.10 g/mol. IUPAC name: 4-(chloromethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole. InChIKey: MOWXKEIRBCMEBE-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NOS |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 4-(chloromethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole |
| InChIKey | MOWXKEIRBCMEBE-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=C(C=NO2)CCl |
Computed by PubChem (NCBI)