CAS 1784096-83-8 appears in our catalog under these names: 2,7-Dichloro-6-methoxybenzo[d]thiazole, 95%, 2,7–Dichloro–6–methoxybenzo(d)thiazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
2,7-dichloro-6-methoxy-1,3-benzothiazole (CAS 1784096-83-8) is a chemical compound with the molecular formula C8H5Cl2NOS and a molecular weight of 234.10 g/mol. IUPAC name: 2,7-dichloro-6-methoxy-1,3-benzothiazole. InChIKey: URUHIOGINWPPKD-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NOS |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 2,7-dichloro-6-methoxy-1,3-benzothiazole |
| InChIKey | URUHIOGINWPPKD-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)N=C(S2)Cl)Cl |
Computed by PubChem (NCBI)