CAS 1369338-93-1 is the registry number for Trans-n-methoxy-n-methyl-2-(trifluoromethyl)cyclopropanecarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Trans-(1S,2S)-N-methoxy-N-methyl-2-(trifluoromethyl)cyclopropane-1-carboxamide (CAS 1369338-93-1) is a chemical compound with the molecular formula C7H10F3NO2 and a molecular weight of 197.15 g/mol. IUPAC name: trans-(1S,2S)-N-methoxy-N-methyl-2-(trifluoromethyl)cyclopropane-1-carboxamide. InChIKey: ULYLGHYOCDXXMC-WHFBIAKZSA-N.
| Molecular formula | C7H10F3NO2 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | trans-(1S,2S)-N-methoxy-N-methyl-2-(trifluoromethyl)cyclopropane-1-carboxamide |
| InChIKey | ULYLGHYOCDXXMC-WHFBIAKZSA-N |
| SMILES | CN(C(=O)[C@H]1C[C@@H]1C(F)(F)F)OC |
Computed by PubChem (NCBI)