CAS 1817630-97-9 is the registry number for (3S,5S)-5-(Hydroxymethyl)-3-(2,2,2-trifluoroethyl)pyrrolidin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5S)-5-(hydroxymethyl)-3-(2,2,2-trifluoroethyl)pyrrolidin-2-one (CAS 1817630-97-9) is a chemical compound with the molecular formula C7H10F3NO2 and a molecular weight of 197.15 g/mol. IUPAC name: (3S,5S)-5-(hydroxymethyl)-3-(2,2,2-trifluoroethyl)pyrrolidin-2-one. InChIKey: HECLJBMIJAZWKV-WHFBIAKZSA-N.
| Molecular formula | C7H10F3NO2 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | (3S,5S)-5-(hydroxymethyl)-3-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
| InChIKey | HECLJBMIJAZWKV-WHFBIAKZSA-N |
| SMILES | C1[C@H](C(=O)N[C@@H]1CO)CC(F)(F)F |
Computed by PubChem (NCBI)